C25H32Cl2N2O4 — CID 100587776
(2R)-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]-N-propylbutanamide (PubChem CID 100587776) has the molecular formula C25H32Cl2N2O4 and a molecular weight of 495.45 g/mol. Its IUPAC name is (2R)-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]-N-propylbutanamide.
| Compound Name | (2R)-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100587776 |
| Molecular Formula | C25H32Cl2N2O4 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | (2R)-2-[(2,4-dichlorophenyl)methyl-[4-(4-methoxyphenoxy)butanoyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@@H](CC)N(Cc1ccc(Cl)cc1Cl)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H32Cl2N2O4/c1-4-14-28-25(31)23(5-2)29(17-18-8-9-19(26)16-22(18)27)24(30)7-6-15-33-21-12-10-20(32-3)11-13-21/h8-13,16,23H,4-7,14-15,17H2,1-3H3,(H,28,31)/t23-/m1/s1 |
| InChIKey | MWCDCEBVIBGTNK-HSZRJFAPSA-N |
| XLogP | 5.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|