C30H37N3O4 — CID 132619852
N-cyclohexyl-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-(2-phenylethyl)amino]butanamide (PubChem CID 132619852) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-(2-phenylethyl)amino]butanamide.
| Compound Name | N-cyclohexyl-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 132619852 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | N-cyclohexyl-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-(2-phenylethyl)amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H37N3O4/c1-2-26(28(35)31-23-14-7-4-8-15-23)32(21-19-22-12-5-3-6-13-22)27(34)18-11-20-33-29(36)24-16-9-10-17-25(24)30(33)37/h3,5-6,9-10,12-13,16-17,23,26H,2,4,7-8,11,14-15,18-21H2,1H3,(H,31,35) |
| InChIKey | FOKOGEIRXRTQAU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|