C30H42N2O2 — CID 100607646
(2R)-N-cyclohexyl-2-[2-phenylethyl-[3-(4-propan-2-ylphenyl)propanoyl]amino]butanamide (PubChem CID 100607646) has the molecular formula C30H42N2O2 and a molecular weight of 462.68 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[2-phenylethyl-[3-(4-propan-2-ylphenyl)propanoyl]amino]butanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[2-phenylethyl-[3-(4-propan-2-ylphenyl)propanoyl]amino]butanamide |
|---|---|
| PubChem CID | 100607646 |
| Molecular Formula | C30H42N2O2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[2-phenylethyl-[3-(4-propan-2-ylphenyl)propanoyl]amino]butanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)CCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C30H42N2O2/c1-4-28(30(34)31-27-13-9-6-10-14-27)32(22-21-24-11-7-5-8-12-24)29(33)20-17-25-15-18-26(19-16-25)23(2)3/h5,7-8,11-12,15-16,18-19,23,27-28H,4,6,9-10,13-14,17,20-22H2,1-3H3,(H,31,34)/t28-/m1/s1 |
| InChIKey | AMWKYCPFNMYTEM-MUUNZHRXSA-N |
| XLogP | 6.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |