C29H39BrN2O3 — CID 132625742
2-[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]-(2-phenylethyl)amino]-N-cyclohexylbutanamide (PubChem CID 132625742) has the molecular formula C29H39BrN2O3 and a molecular weight of 543.55 g/mol. Its IUPAC name is 2-[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]-(2-phenylethyl)amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]-(2-phenylethyl)amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132625742 |
| Molecular Formula | C29H39BrN2O3 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 2-[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]-(2-phenylethyl)amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)COc1ccc(C(C)C)cc1Br |
| InChI | InChI=1S/C29H39BrN2O3/c1-4-26(29(34)31-24-13-9-6-10-14-24)32(18-17-22-11-7-5-8-12-22)28(33)20-35-27-16-15-23(21(2)3)19-25(27)30/h5,7-8,11-12,15-16,19,21,24,26H,4,6,9-10,13-14,17-18,20H2,1-3H3,(H,31,34) |
| InChIKey | RYUJLOVZRJDWGL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |