C28H38N2O3 — CID 100606311
(2S)-N-cyclohexyl-2-[[2-(3,5-dimethylphenoxy)acetyl]-(2-phenylethyl)amino]butanamide (PubChem CID 100606311) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[[2-(3,5-dimethylphenoxy)acetyl]-(2-phenylethyl)amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[[2-(3,5-dimethylphenoxy)acetyl]-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 100606311 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[[2-(3,5-dimethylphenoxy)acetyl]-(2-phenylethyl)amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)COc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C28H38N2O3/c1-4-26(28(32)29-24-13-9-6-10-14-24)30(16-15-23-11-7-5-8-12-23)27(31)20-33-25-18-21(2)17-22(3)19-25/h5,7-8,11-12,17-19,24,26H,4,6,9-10,13-16,20H2,1-3H3,(H,29,32)/t26-/m0/s1 |
| InChIKey | COGVTNYPQCTLMM-SANMLTNESA-N |
| XLogP | 4.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |