C25H31ClN2O3 — CID 132612029
2-[[2-(3-chlorophenoxy)acetyl]-(2-phenylethyl)amino]-N-cyclopentylbutanamide (PubChem CID 132612029) has the molecular formula C25H31ClN2O3 and a molecular weight of 442.99 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenoxy)acetyl]-(2-phenylethyl)amino]-N-cyclopentylbutanamide.
| Compound Name | 2-[[2-(3-chlorophenoxy)acetyl]-(2-phenylethyl)amino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 132612029 |
| Molecular Formula | C25H31ClN2O3 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-[[2-(3-chlorophenoxy)acetyl]-(2-phenylethyl)amino]-N-cyclopentylbutanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(CCc1ccccc1)C(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H31ClN2O3/c1-2-23(25(30)27-21-12-6-7-13-21)28(16-15-19-9-4-3-5-10-19)24(29)18-31-22-14-8-11-20(26)17-22/h3-5,8-11,14,17,21,23H,2,6-7,12-13,15-16,18H2,1H3,(H,27,30) |
| InChIKey | KAUCHJAWEAMUPR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |