C26H33ClN2O3 — CID 132613698
2-[[2-(3-chlorophenoxy)acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 132613698) has the molecular formula C26H33ClN2O3 and a molecular weight of 457.01 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenoxy)acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[[2-(3-chlorophenoxy)acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132613698 |
| Molecular Formula | C26H33ClN2O3 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-[[2-(3-chlorophenoxy)acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccc(C)cc1)C(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H33ClN2O3/c1-3-24(26(31)28-22-9-5-4-6-10-22)29(17-20-14-12-19(2)13-15-20)25(30)18-32-23-11-7-8-21(27)16-23/h7-8,11-16,22,24H,3-6,9-10,17-18H2,1-2H3,(H,28,31) |
| InChIKey | BGPPGIXNLGTVQQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |