C25H30ClFN2O3 — CID 132614186
2-[[2-(3-chlorophenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 132614186) has the molecular formula C25H30ClFN2O3 and a molecular weight of 460.98 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[[2-(3-chlorophenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132614186 |
| Molecular Formula | C25H30ClFN2O3 |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[[2-(3-chlorophenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccc(F)cc1)C(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H30ClFN2O3/c1-2-23(25(31)28-21-8-4-3-5-9-21)29(16-18-11-13-20(27)14-12-18)24(30)17-32-22-10-6-7-19(26)15-22/h6-7,10-15,21,23H,2-5,8-9,16-17H2,1H3,(H,28,31) |
| InChIKey | MBDFXSLSVYTGIB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |