C25H31FN2O3 — CID 132610392
N-cyclohexyl-2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]butanamide (PubChem CID 132610392) has the molecular formula C25H31FN2O3 and a molecular weight of 426.53 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]butanamide.
| Compound Name | N-cyclohexyl-2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]butanamide |
|---|---|
| PubChem CID | 132610392 |
| Molecular Formula | C25H31FN2O3 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-cyclohexyl-2-[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccc(F)cc1)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C25H31FN2O3/c1-2-23(25(30)27-21-9-5-3-6-10-21)28(17-19-13-15-20(26)16-14-19)24(29)18-31-22-11-7-4-8-12-22/h4,7-8,11-16,21,23H,2-3,5-6,9-10,17-18H2,1H3,(H,27,30) |
| InChIKey | GNOYBUAKEXRPGU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |