C26H33ClN2O2 — CID 132611837
2-[[2-(3-chlorophenyl)acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 132611837) has the molecular formula C26H33ClN2O2 and a molecular weight of 441.02 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenyl)acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[[2-(3-chlorophenyl)acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132611837 |
| Molecular Formula | C26H33ClN2O2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[[2-(3-chlorophenyl)acetyl]-[(4-methylphenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccc(C)cc1)C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H33ClN2O2/c1-3-24(26(31)28-23-10-5-4-6-11-23)29(18-20-14-12-19(2)13-15-20)25(30)17-21-8-7-9-22(27)16-21/h7-9,12-16,23-24H,3-6,10-11,17-18H2,1-2H3,(H,28,31) |
| InChIKey | WLIHKIPMPCBWKT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |