C25H30Cl2N2O2 — CID 132614246
2-[[2-(3-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 132614246) has the molecular formula C25H30Cl2N2O2 and a molecular weight of 461.43 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[[2-(3-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132614246 |
| Molecular Formula | C25H30Cl2N2O2 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-[[2-(3-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccc(Cl)cc1)C(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H30Cl2N2O2/c1-2-23(25(31)28-22-9-4-3-5-10-22)29(17-18-11-13-20(26)14-12-18)24(30)16-19-7-6-8-21(27)15-19/h6-8,11-15,22-23H,2-5,9-10,16-17H2,1H3,(H,28,31) |
| InChIKey | KVPUOHMZXSQGMI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |