C26H34N2O4 — CID 132611556
N-cyclopentyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(4-methylphenyl)methyl]amino]butanamide (PubChem CID 132611556) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(4-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-cyclopentyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(4-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132611556 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | N-cyclopentyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(4-methylphenyl)methyl]amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccc(C)cc1)C(=O)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H34N2O4/c1-4-24(26(30)27-21-7-5-6-8-21)28(17-20-11-9-19(2)10-12-20)25(29)18-32-23-15-13-22(31-3)14-16-23/h9-16,21,24H,4-8,17-18H2,1-3H3,(H,27,30) |
| InChIKey | PXNLIIUFMPOHSL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |