C28H38N2O4 — CID 132614985
N-cyclopentyl-2-[(4-methoxyphenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]butanamide (PubChem CID 132614985) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is N-cyclopentyl-2-[(4-methoxyphenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]butanamide.
| Compound Name | N-cyclopentyl-2-[(4-methoxyphenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132614985 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | N-cyclopentyl-2-[(4-methoxyphenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccc(OC)cc1)C(=O)COc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C28H38N2O4/c1-5-26(28(32)29-23-8-6-7-9-23)30(18-21-10-14-24(33-4)15-11-21)27(31)19-34-25-16-12-22(13-17-25)20(2)3/h10-17,20,23,26H,5-9,18-19H2,1-4H3,(H,29,32) |
| InChIKey | KVVXEVBWHWLUGQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |