C26H34N2O5 — CID 132613364
N-cyclopentyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide (PubChem CID 132613364) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | N-cyclopentyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132613364 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | N-cyclopentyl-2-[[2-(4-methoxyphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1cccc(OC)c1)C(=O)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H34N2O5/c1-4-24(26(30)27-20-9-5-6-10-20)28(17-19-8-7-11-23(16-19)32-3)25(29)18-33-22-14-12-21(31-2)13-15-22/h7-8,11-16,20,24H,4-6,9-10,17-18H2,1-3H3,(H,27,30) |
| InChIKey | XTKZSMHDVJPUIO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |