C27H36N2O2 — CID 100608811
(2S)-N-cyclohexyl-2-[[2-(3-methylphenyl)acetyl]-(2-phenylethyl)amino]butanamide (PubChem CID 100608811) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[[2-(3-methylphenyl)acetyl]-(2-phenylethyl)amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[[2-(3-methylphenyl)acetyl]-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 100608811 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[[2-(3-methylphenyl)acetyl]-(2-phenylethyl)amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C27H36N2O2/c1-3-25(27(31)28-24-15-8-5-9-16-24)29(18-17-22-12-6-4-7-13-22)26(30)20-23-14-10-11-21(2)19-23/h4,6-7,10-14,19,24-25H,3,5,8-9,15-18,20H2,1-2H3,(H,28,31)/t25-/m0/s1 |
| InChIKey | LUFXQCVBOSXSRD-VWLOTQADSA-N |
| XLogP | 4.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |