C27H35ClN2O2S — CID 132617687
2-[3-(4-chlorophenyl)sulfanylpropanoyl-(2-phenylethyl)amino]-N-cyclohexylbutanamide (PubChem CID 132617687) has the molecular formula C27H35ClN2O2S and a molecular weight of 487.11 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)sulfanylpropanoyl-(2-phenylethyl)amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[3-(4-chlorophenyl)sulfanylpropanoyl-(2-phenylethyl)amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132617687 |
| Molecular Formula | C27H35ClN2O2S |
| Molecular Weight | 487.11 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[3-(4-chlorophenyl)sulfanylpropanoyl-(2-phenylethyl)amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)CCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H35ClN2O2S/c1-2-25(27(32)29-23-11-7-4-8-12-23)30(19-17-21-9-5-3-6-10-21)26(31)18-20-33-24-15-13-22(28)14-16-24/h3,5-6,9-10,13-16,23,25H,2,4,7-8,11-12,17-20H2,1H3,(H,29,32) |
| InChIKey | JKEAXBGUHRUXCL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.11 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |