C26H34N2O2S — CID 132611624
N-cyclopentyl-2-[2-phenylethyl(3-phenylsulfanylpropanoyl)amino]butanamide (PubChem CID 132611624) has the molecular formula C26H34N2O2S and a molecular weight of 438.64 g/mol. Its IUPAC name is N-cyclopentyl-2-[2-phenylethyl(3-phenylsulfanylpropanoyl)amino]butanamide.
| Compound Name | N-cyclopentyl-2-[2-phenylethyl(3-phenylsulfanylpropanoyl)amino]butanamide |
|---|---|
| PubChem CID | 132611624 |
| Molecular Formula | C26H34N2O2S |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-cyclopentyl-2-[2-phenylethyl(3-phenylsulfanylpropanoyl)amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(CCc1ccccc1)C(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C26H34N2O2S/c1-2-24(26(30)27-22-13-9-10-14-22)28(19-17-21-11-5-3-6-12-21)25(29)18-20-31-23-15-7-4-8-16-23/h3-8,11-12,15-16,22,24H,2,9-10,13-14,17-20H2,1H3,(H,27,30) |
| InChIKey | RLTDHSCPINPGOR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |