C25H32N2O2S — CID 100522229
(2S)-2-[benzyl-(2-phenylsulfanylacetyl)amino]-N-cyclohexylbutanamide (PubChem CID 100522229) has the molecular formula C25H32N2O2S and a molecular weight of 424.61 g/mol. Its IUPAC name is (2S)-2-[benzyl-(2-phenylsulfanylacetyl)amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[benzyl-(2-phenylsulfanylacetyl)amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100522229 |
| Molecular Formula | C25H32N2O2S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (2S)-2-[benzyl-(2-phenylsulfanylacetyl)amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C25H32N2O2S/c1-2-23(25(29)26-21-14-8-4-9-15-21)27(18-20-12-6-3-7-13-20)24(28)19-30-22-16-10-5-11-17-22/h3,5-7,10-13,16-17,21,23H,2,4,8-9,14-15,18-19H2,1H3,(H,26,29)/t23-/m0/s1 |
| InChIKey | GQWKXHNXPXFORM-QHCPKHFHSA-N |
| XLogP | 5.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |