C26H34N2O3S — CID 100588455
(2S)-N-cyclohexyl-2-[(3-methoxyphenyl)methyl-(2-phenylsulfanylacetyl)amino]butanamide (PubChem CID 100588455) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(3-methoxyphenyl)methyl-(2-phenylsulfanylacetyl)amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(3-methoxyphenyl)methyl-(2-phenylsulfanylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 100588455 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(3-methoxyphenyl)methyl-(2-phenylsulfanylacetyl)amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1cccc(OC)c1)C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C26H34N2O3S/c1-3-24(26(30)27-21-12-6-4-7-13-21)28(18-20-11-10-14-22(17-20)31-2)25(29)19-32-23-15-8-5-9-16-23/h5,8-11,14-17,21,24H,3-4,6-7,12-13,18-19H2,1-2H3,(H,27,30)/t24-/m0/s1 |
| InChIKey | NXPDESWIDPQANX-DEOSSOPVSA-N |
| XLogP | 5.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |