C32H38N2O2 — CID 100527162
(2S)-2-[benzyl(3,3-diphenylpropanoyl)amino]-N-cyclohexylbutanamide (PubChem CID 100527162) has the molecular formula C32H38N2O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is (2S)-2-[benzyl(3,3-diphenylpropanoyl)amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[benzyl(3,3-diphenylpropanoyl)amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100527162 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (2S)-2-[benzyl(3,3-diphenylpropanoyl)amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38N2O2/c1-2-30(32(36)33-28-21-13-6-14-22-28)34(24-25-15-7-3-8-16-25)31(35)23-29(26-17-9-4-10-18-26)27-19-11-5-12-20-27/h3-5,7-12,15-20,28-30H,2,6,13-14,21-24H2,1H3,(H,33,36)/t30-/m0/s1 |
| InChIKey | OOZQEFVNEXAQSN-PMERELPUSA-N |
| XLogP | 6.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |