C33H40N2O2 — CID 100547623
(2S)-N-cyclohexyl-2-[3,3-diphenylpropanoyl-[(4-methylphenyl)methyl]amino]butanamide (PubChem CID 100547623) has the molecular formula C33H40N2O2 and a molecular weight of 496.70 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[3,3-diphenylpropanoyl-[(4-methylphenyl)methyl]amino]butanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[3,3-diphenylpropanoyl-[(4-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 100547623 |
| Molecular Formula | C33H40N2O2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[3,3-diphenylpropanoyl-[(4-methylphenyl)methyl]amino]butanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccc(C)cc1)C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H40N2O2/c1-3-31(33(37)34-29-17-11-6-12-18-29)35(24-26-21-19-25(2)20-22-26)32(36)23-30(27-13-7-4-8-14-27)28-15-9-5-10-16-28/h4-5,7-10,13-16,19-22,29-31H,3,6,11-12,17-18,23-24H2,1-2H3,(H,34,37)/t31-/m0/s1 |
| InChIKey | VKFSDLOPHWLHTP-HKBQPEDESA-N |
| XLogP | 6.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |