C27H36N2O3 — CID 100542461
(2R)-N-cyclohexyl-2-[[2-(2-methylphenoxy)acetyl]-[(4-methylphenyl)methyl]amino]butanamide (PubChem CID 100542461) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[[2-(2-methylphenoxy)acetyl]-[(4-methylphenyl)methyl]amino]butanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[[2-(2-methylphenoxy)acetyl]-[(4-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 100542461 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[[2-(2-methylphenoxy)acetyl]-[(4-methylphenyl)methyl]amino]butanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1ccc(C)cc1)C(=O)COc1ccccc1C |
| InChI | InChI=1S/C27H36N2O3/c1-4-24(27(31)28-23-11-6-5-7-12-23)29(18-22-16-14-20(2)15-17-22)26(30)19-32-25-13-9-8-10-21(25)3/h8-10,13-17,23-24H,4-7,11-12,18-19H2,1-3H3,(H,28,31)/t24-/m1/s1 |
| InChIKey | TZNOHKRJNHUDIQ-XMMPIXPASA-N |
| XLogP | 4.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |