C26H34N2O3 — CID 132947939
2-[benzyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-N-cyclopentylbutanamide (PubChem CID 132947939) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-[benzyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-N-cyclopentylbutanamide.
| Compound Name | 2-[benzyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-N-cyclopentylbutanamide |
|---|---|
| PubChem CID | 132947939 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 2-[benzyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-N-cyclopentylbutanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccccc1)C(=O)COc1cc(C)ccc1C |
| InChI | InChI=1S/C26H34N2O3/c1-4-23(26(30)27-22-12-8-9-13-22)28(17-21-10-6-5-7-11-21)25(29)18-31-24-16-19(2)14-15-20(24)3/h5-7,10-11,14-16,22-23H,4,8-9,12-13,17-18H2,1-3H3,(H,27,30) |
| InChIKey | PAXXHVYUAQZTCI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |