C28H38N2O3 — CID 132612854
2-[benzyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-cyclohexylbutanamide (PubChem CID 132612854) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is 2-[benzyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-cyclohexylbutanamide.
| Compound Name | 2-[benzyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 132612854 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 2-[benzyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-cyclohexylbutanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)COc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C28H38N2O3/c1-5-25(28(32)29-24-14-10-7-11-15-24)30(18-23-12-8-6-9-13-23)27(31)19-33-26-17-20(2)16-21(3)22(26)4/h6,8-9,12-13,16-17,24-25H,5,7,10-11,14-15,18-19H2,1-4H3,(H,29,32) |
| InChIKey | DGXJSAGNOUKVBM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |