C26H36N2O3 — CID 132709845
2-[benzyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butan-2-ylbutanamide (PubChem CID 132709845) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 2-[benzyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butan-2-ylbutanamide.
| Compound Name | 2-[benzyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butan-2-ylbutanamide |
|---|---|
| PubChem CID | 132709845 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 2-[benzyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butan-2-ylbutanamide |
| SMILES | CCC(C)NC(=O)C(CC)N(Cc1ccccc1)C(=O)COc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C26H36N2O3/c1-7-20(5)27-26(30)23(8-2)28(16-22-12-10-9-11-13-22)25(29)17-31-24-15-18(3)14-19(4)21(24)6/h9-15,20,23H,7-8,16-17H2,1-6H3,(H,27,30) |
| InChIKey | DVCXQBVYNGCMHT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |