C28H32N2O2 — CID 132668468
2-[3,3-diphenylpropanoyl-[(4-methylphenyl)methyl]amino]-N-methylbutanamide (PubChem CID 132668468) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[3,3-diphenylpropanoyl-[(4-methylphenyl)methyl]amino]-N-methylbutanamide.
| Compound Name | 2-[3,3-diphenylpropanoyl-[(4-methylphenyl)methyl]amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 132668468 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2-[3,3-diphenylpropanoyl-[(4-methylphenyl)methyl]amino]-N-methylbutanamide |
| SMILES | CCC(C(=O)NC)N(Cc1ccc(C)cc1)C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O2/c1-4-26(28(32)29-3)30(20-22-17-15-21(2)16-18-22)27(31)19-25(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,25-26H,4,19-20H2,1-3H3,(H,29,32) |
| InChIKey | NAJSKZYCRKJOLY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |