C29H33ClN2O2 — CID 100575770
(2R)-2-[(4-chlorophenyl)methyl-(3,3-diphenylpropanoyl)amino]-N-propylbutanamide (PubChem CID 100575770) has the molecular formula C29H33ClN2O2 and a molecular weight of 477.05 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)methyl-(3,3-diphenylpropanoyl)amino]-N-propylbutanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)methyl-(3,3-diphenylpropanoyl)amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100575770 |
| Molecular Formula | C29H33ClN2O2 |
| Molecular Weight | 477.05 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)methyl-(3,3-diphenylpropanoyl)amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@@H](CC)N(Cc1ccc(Cl)cc1)C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H33ClN2O2/c1-3-19-31-29(34)27(4-2)32(21-22-15-17-25(30)18-16-22)28(33)20-26(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,26-27H,3-4,19-21H2,1-2H3,(H,31,34)/t27-/m1/s1 |
| InChIKey | JEULPGIPXGQJCF-HHHXNRCGSA-N |
| XLogP | 6.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.05 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |