C26H34N2O2 — CID 100528650
(2S)-2-[benzyl-[2-(2-methylphenyl)acetyl]amino]-N-cyclohexylbutanamide (PubChem CID 100528650) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is (2S)-2-[benzyl-[2-(2-methylphenyl)acetyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[benzyl-[2-(2-methylphenyl)acetyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100528650 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (2S)-2-[benzyl-[2-(2-methylphenyl)acetyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1)C(=O)Cc1ccccc1C |
| InChI | InChI=1S/C26H34N2O2/c1-3-24(26(30)27-23-16-8-5-9-17-23)28(19-21-13-6-4-7-14-21)25(29)18-22-15-11-10-12-20(22)2/h4,6-7,10-15,23-24H,3,5,8-9,16-19H2,1-2H3,(H,27,30)/t24-/m0/s1 |
| InChIKey | BGZZWXMDOOLETJ-DEOSSOPVSA-N |
| XLogP | 4.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |