C26H33FN2O2 — CID 132610236
N-cyclohexyl-2-[[2-(2-fluorophenyl)acetyl]-[(2-methylphenyl)methyl]amino]butanamide (PubChem CID 132610236) has the molecular formula C26H33FN2O2 and a molecular weight of 424.56 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(2-fluorophenyl)acetyl]-[(2-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-cyclohexyl-2-[[2-(2-fluorophenyl)acetyl]-[(2-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132610236 |
| Molecular Formula | C26H33FN2O2 |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-cyclohexyl-2-[[2-(2-fluorophenyl)acetyl]-[(2-methylphenyl)methyl]amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccccc1C)C(=O)Cc1ccccc1F |
| InChI | InChI=1S/C26H33FN2O2/c1-3-24(26(31)28-22-14-5-4-6-15-22)29(18-21-13-8-7-11-19(21)2)25(30)17-20-12-9-10-16-23(20)27/h7-13,16,22,24H,3-6,14-15,17-18H2,1-2H3,(H,28,31) |
| InChIKey | KKSXSSOOHSWWLE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |