C37H39FN2O2 — CID 100610495
(2R)-N-cyclohexyl-2-[3,3-diphenylpropanoyl-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100610495) has the molecular formula C37H39FN2O2 and a molecular weight of 562.73 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[3,3-diphenylpropanoyl-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[3,3-diphenylpropanoyl-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100610495 |
| Molecular Formula | C37H39FN2O2 |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[3,3-diphenylpropanoyl-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H39FN2O2/c38-34-24-14-13-21-31(34)27-40(36(41)26-33(29-17-7-2-8-18-29)30-19-9-3-10-20-30)35(25-28-15-5-1-6-16-28)37(42)39-32-22-11-4-12-23-32/h1-3,5-10,13-21,24,32-33,35H,4,11-12,22-23,25-27H2,(H,39,42)/t35-/m1/s1 |
| InChIKey | ZNYAPAZKWSLRNZ-PGUFJCEWSA-N |
| XLogP | 7.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |