C37H38Cl2N2O2 — CID 100647407
(2R)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-(3,3-diphenylpropanoyl)amino]-3-phenylpropanamide (PubChem CID 100647407) has the molecular formula C37H38Cl2N2O2 and a molecular weight of 613.63 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-(3,3-diphenylpropanoyl)amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-(3,3-diphenylpropanoyl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100647407 |
| Molecular Formula | C37H38Cl2N2O2 |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-(3,3-diphenylpropanoyl)amino]-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H38Cl2N2O2/c38-31-22-21-30(34(39)24-31)26-41(36(42)25-33(28-15-7-2-8-16-28)29-17-9-3-10-18-29)35(23-27-13-5-1-6-14-27)37(43)40-32-19-11-4-12-20-32/h1-3,5-10,13-18,21-22,24,32-33,35H,4,11-12,19-20,23,25-26H2,(H,40,43)/t35-/m1/s1 |
| InChIKey | JYNXPZIKWLBRMJ-PGUFJCEWSA-N |
| XLogP | 8.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |