C32H35Cl3N2O2S — CID 133253774
4-(4-chlorophenyl)sulfanyl-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]butanamide (PubChem CID 133253774) has the molecular formula C32H35Cl3N2O2S and a molecular weight of 618.07 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 133253774 |
| Molecular Formula | C32H35Cl3N2O2S |
| Molecular Weight | 618.07 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2,4-dichlorophenyl)methyl]butanamide |
| SMILES | O=C(NC1CCCCC1)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H35Cl3N2O2S/c33-25-15-17-28(18-16-25)40-19-7-12-31(38)37(22-24-13-14-26(34)21-29(24)35)30(20-23-8-3-1-4-9-23)32(39)36-27-10-5-2-6-11-27/h1,3-4,8-9,13-18,21,27,30H,2,5-7,10-12,19-20,22H2,(H,36,39) |
| InChIKey | GEMLYDBYVWRJHA-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.07 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|