C30H33Cl3N2O2S — CID 133193485
N-[1-(tert-butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanyl-N-[(2,4-dichlorophenyl)methyl]butanamide (PubChem CID 133193485) has the molecular formula C30H33Cl3N2O2S and a molecular weight of 592.03 g/mol. Its IUPAC name is N-[1-(tert-butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanyl-N-[(2,4-dichlorophenyl)methyl]butanamide.
| Compound Name | N-[1-(tert-butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanyl-N-[(2,4-dichlorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 133193485 |
| Molecular Formula | C30H33Cl3N2O2S |
| Molecular Weight | 592.03 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | N-[1-(tert-butylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-chlorophenyl)sulfanyl-N-[(2,4-dichlorophenyl)methyl]butanamide |
| SMILES | CC(C)(C)NC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1Cl)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H33Cl3N2O2S/c1-30(2,3)34-29(37)27(18-21-8-5-4-6-9-21)35(20-22-11-12-24(32)19-26(22)33)28(36)10-7-17-38-25-15-13-23(31)14-16-25/h4-6,8-9,11-16,19,27H,7,10,17-18,20H2,1-3H3,(H,34,37) |
| InChIKey | JGMYZSHFDMIXMA-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.03 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|