C31H34Cl2N2O2S — CID 133247768
N-[(2-chlorophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]butanamide (PubChem CID 133247768) has the molecular formula C31H34Cl2N2O2S and a molecular weight of 569.60 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]butanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 133247768 |
| Molecular Formula | C31H34Cl2N2O2S |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]butanamide |
| SMILES | O=C(NC1CCCC1)C(Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H34Cl2N2O2S/c32-25-16-18-27(19-17-25)38-20-8-15-30(36)35(22-24-11-4-7-14-28(24)33)29(21-23-9-2-1-3-10-23)31(37)34-26-12-5-6-13-26/h1-4,7,9-11,14,16-19,26,29H,5-6,8,12-13,15,20-22H2,(H,34,37) |
| InChIKey | KOLAQEMAOIWROT-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|