C31H34BrClN2O2S — CID 100527861
N-[(4-bromophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[(2S)-1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]butanamide (PubChem CID 100527861) has the molecular formula C31H34BrClN2O2S and a molecular weight of 614.05 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[(2S)-1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]butanamide.
| Compound Name | N-[(4-bromophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[(2S)-1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 100527861 |
| Molecular Formula | C31H34BrClN2O2S |
| Molecular Weight | 614.05 g/mol |
| Exact Mass | 612.12 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[(2S)-1-(cyclopentylamino)-1-oxo-3-phenylpropan-2-yl]butanamide |
| SMILES | O=C(NC1CCCC1)[C@H](Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H34BrClN2O2S/c32-25-14-12-24(13-15-25)22-35(30(36)11-6-20-38-28-18-16-26(33)17-19-28)29(21-23-7-2-1-3-8-23)31(37)34-27-9-4-5-10-27/h1-3,7-8,12-19,27,29H,4-6,9-11,20-22H2,(H,34,37)/t29-/m0/s1 |
| InChIKey | UAFFNRWLRZMHED-LJAQVGFWSA-N |
| XLogP | 7.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.05 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|