C28H30BrClN2O2S — CID 132630841
N-[(4-bromophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]butanamide (PubChem CID 132630841) has the molecular formula C28H30BrClN2O2S and a molecular weight of 573.98 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]butanamide.
| Compound Name | N-[(4-bromophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 132630841 |
| Molecular Formula | C28H30BrClN2O2S |
| Molecular Weight | 573.98 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-4-(4-chlorophenyl)sulfanyl-N-[1-(ethylamino)-1-oxo-3-phenylpropan-2-yl]butanamide |
| SMILES | CCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H30BrClN2O2S/c1-2-31-28(34)26(19-21-7-4-3-5-8-21)32(20-22-10-12-23(29)13-11-22)27(33)9-6-18-35-25-16-14-24(30)15-17-25/h3-5,7-8,10-17,26H,2,6,9,18-20H2,1H3,(H,31,34) |
| InChIKey | NARYHIUYKCHXMI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.98 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|