C32H36ClFN2O3 — CID 133252357
4-(4-chlorophenoxy)-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-fluorophenyl)methyl]butanamide (PubChem CID 133252357) has the molecular formula C32H36ClFN2O3 and a molecular weight of 551.10 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-fluorophenyl)methyl]butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 133252357 |
| Molecular Formula | C32H36ClFN2O3 |
| Molecular Weight | 551.10 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-[1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(2-fluorophenyl)methyl]butanamide |
| SMILES | O=C(NC1CCCCC1)C(Cc1ccccc1)N(Cc1ccccc1F)C(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H36ClFN2O3/c33-26-17-19-28(20-18-26)39-21-9-16-31(37)36(23-25-12-7-8-15-29(25)34)30(22-24-10-3-1-4-11-24)32(38)35-27-13-5-2-6-14-27/h1,3-4,7-8,10-12,15,17-20,27,30H,2,5-6,9,13-14,16,21-23H2,(H,35,38) |
| InChIKey | MOQWCYMIMXQPEW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.10 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|