C24H28Cl2N2O2 — CID 132612519
N-cyclopentyl-2-[(2,4-dichlorophenyl)methyl-(2-phenylacetyl)amino]butanamide (PubChem CID 132612519) has the molecular formula C24H28Cl2N2O2 and a molecular weight of 447.41 g/mol. Its IUPAC name is N-cyclopentyl-2-[(2,4-dichlorophenyl)methyl-(2-phenylacetyl)amino]butanamide.
| Compound Name | N-cyclopentyl-2-[(2,4-dichlorophenyl)methyl-(2-phenylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 132612519 |
| Molecular Formula | C24H28Cl2N2O2 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-cyclopentyl-2-[(2,4-dichlorophenyl)methyl-(2-phenylacetyl)amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCC1)N(Cc1ccc(Cl)cc1Cl)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H28Cl2N2O2/c1-2-22(24(30)27-20-10-6-7-11-20)28(16-18-12-13-19(25)15-21(18)26)23(29)14-17-8-4-3-5-9-17/h3-5,8-9,12-13,15,20,22H,2,6-7,10-11,14,16H2,1H3,(H,27,30) |
| InChIKey | OTFOIGLEMALJMY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |