C26H32Cl2N2O2 — CID 132616133
N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-(3-phenylpropanoyl)amino]butanamide (PubChem CID 132616133) has the molecular formula C26H32Cl2N2O2 and a molecular weight of 475.46 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-(3-phenylpropanoyl)amino]butanamide.
| Compound Name | N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-(3-phenylpropanoyl)amino]butanamide |
|---|---|
| PubChem CID | 132616133 |
| Molecular Formula | C26H32Cl2N2O2 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-(3-phenylpropanoyl)amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccc(Cl)cc1Cl)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C26H32Cl2N2O2/c1-2-24(26(32)29-22-11-7-4-8-12-22)30(18-20-14-15-21(27)17-23(20)28)25(31)16-13-19-9-5-3-6-10-19/h3,5-6,9-10,14-15,17,22,24H,2,4,7-8,11-13,16,18H2,1H3,(H,29,32) |
| InChIKey | RSRXZIVUGPXTSZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |