C25H30ClFN2O2S — CID 133198777
4-(4-chlorophenyl)sulfanyl-N-[1-(cyclopentylamino)-1-oxopropan-2-yl]-N-[(2-fluorophenyl)methyl]butanamide (PubChem CID 133198777) has the molecular formula C25H30ClFN2O2S and a molecular weight of 477.05 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[1-(cyclopentylamino)-1-oxopropan-2-yl]-N-[(2-fluorophenyl)methyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[1-(cyclopentylamino)-1-oxopropan-2-yl]-N-[(2-fluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 133198777 |
| Molecular Formula | C25H30ClFN2O2S |
| Molecular Weight | 477.05 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[1-(cyclopentylamino)-1-oxopropan-2-yl]-N-[(2-fluorophenyl)methyl]butanamide |
| SMILES | CC(C(=O)NC1CCCC1)N(Cc1ccccc1F)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H30ClFN2O2S/c1-18(25(31)28-21-8-3-4-9-21)29(17-19-7-2-5-10-23(19)27)24(30)11-6-16-32-22-14-12-20(26)13-15-22/h2,5,7,10,12-15,18,21H,3-4,6,8-9,11,16-17H2,1H3,(H,28,31) |
| InChIKey | KPVJZMIFQGTAMR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.05 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|