C24H31ClN2O3S — CID 132676345
4-(4-chlorophenyl)sulfanyl-N-[(3-methoxyphenyl)methyl]-N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide (PubChem CID 132676345) has the molecular formula C24H31ClN2O3S and a molecular weight of 463.04 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[(3-methoxyphenyl)methyl]-N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[(3-methoxyphenyl)methyl]-N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 132676345 |
| Molecular Formula | C24H31ClN2O3S |
| Molecular Weight | 463.04 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[(3-methoxyphenyl)methyl]-N-[1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide |
| SMILES | COc1cccc(CN(C(=O)CCCSc2ccc(Cl)cc2)C(C)C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C24H31ClN2O3S/c1-17(2)26-24(29)18(3)27(16-19-7-5-8-21(15-19)30-4)23(28)9-6-14-31-22-12-10-20(25)11-13-22/h5,7-8,10-13,15,17-18H,6,9,14,16H2,1-4H3,(H,26,29) |
| InChIKey | MTOBSZBRXGIRNB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.04 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|