C23H29ClN2O3S — CID 132674681
2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(4-methoxyphenyl)methyl]amino]-N-methylbutanamide (PubChem CID 132674681) has the molecular formula C23H29ClN2O3S and a molecular weight of 449.02 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(4-methoxyphenyl)methyl]amino]-N-methylbutanamide.
| Compound Name | 2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(4-methoxyphenyl)methyl]amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 132674681 |
| Molecular Formula | C23H29ClN2O3S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfanylbutanoyl-[(4-methoxyphenyl)methyl]amino]-N-methylbutanamide |
| SMILES | CCC(C(=O)NC)N(Cc1ccc(OC)cc1)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H29ClN2O3S/c1-4-21(23(28)25-2)26(16-17-7-11-19(29-3)12-8-17)22(27)6-5-15-30-20-13-9-18(24)10-14-20/h7-14,21H,4-6,15-16H2,1-3H3,(H,25,28) |
| InChIKey | UOFKGJLYZXKBEY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|