C22H26BrClN2O2 — CID 133145829
2-[(3-bromophenyl)methyl-[2-(4-chlorophenyl)acetyl]amino]-N-tert-butylpropanamide (PubChem CID 133145829) has the molecular formula C22H26BrClN2O2 and a molecular weight of 465.82 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(4-chlorophenyl)acetyl]amino]-N-tert-butylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(4-chlorophenyl)acetyl]amino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 133145829 |
| Molecular Formula | C22H26BrClN2O2 |
| Molecular Weight | 465.82 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(4-chlorophenyl)acetyl]amino]-N-tert-butylpropanamide |
| SMILES | CC(C(=O)NC(C)(C)C)N(Cc1cccc(Br)c1)C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26BrClN2O2/c1-15(21(28)25-22(2,3)4)26(14-17-6-5-7-18(23)12-17)20(27)13-16-8-10-19(24)11-9-16/h5-12,15H,13-14H2,1-4H3,(H,25,28) |
| InChIKey | FAZFPNGLEWXBSV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.82 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |