C25H32Cl2N2O2S — CID 132946122
N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-methylphenyl)sulfanylpropanoyl]amino]butanamide (PubChem CID 132946122) has the molecular formula C25H32Cl2N2O2S and a molecular weight of 495.52 g/mol. Its IUPAC name is N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-methylphenyl)sulfanylpropanoyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-methylphenyl)sulfanylpropanoyl]amino]butanamide |
|---|---|
| PubChem CID | 132946122 |
| Molecular Formula | C25H32Cl2N2O2S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-methylphenyl)sulfanylpropanoyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1c(Cl)cccc1Cl)C(=O)CCSc1ccc(C)cc1 |
| InChI | InChI=1S/C25H32Cl2N2O2S/c1-4-6-15-28-25(31)23(5-2)29(17-20-21(26)8-7-9-22(20)27)24(30)14-16-32-19-12-10-18(3)11-13-19/h7-13,23H,4-6,14-17H2,1-3H3,(H,28,31) |
| InChIKey | DYJQZJFIJZDAGF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|