C23H28Cl2N2O2S — CID 132721718
N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(4-methylphenyl)sulfanylacetyl]amino]propanamide (PubChem CID 132721718) has the molecular formula C23H28Cl2N2O2S and a molecular weight of 467.46 g/mol. Its IUPAC name is N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(4-methylphenyl)sulfanylacetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(4-methylphenyl)sulfanylacetyl]amino]propanamide |
|---|---|
| PubChem CID | 132721718 |
| Molecular Formula | C23H28Cl2N2O2S |
| Molecular Weight | 467.46 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(4-methylphenyl)sulfanylacetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)CSc1ccc(C)cc1 |
| InChI | InChI=1S/C23H28Cl2N2O2S/c1-4-5-13-26-23(29)17(3)27(14-19-20(24)7-6-8-21(19)25)22(28)15-30-18-11-9-16(2)10-12-18/h6-12,17H,4-5,13-15H2,1-3H3,(H,26,29) |
| InChIKey | VDFNJKOKYVRZEL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|