C25H32Cl2N2O2S — CID 132946123
N-butyl-2-[(2-chlorophenyl)methyl-[4-(4-chlorophenyl)sulfanylbutanoyl]amino]butanamide (PubChem CID 132946123) has the molecular formula C25H32Cl2N2O2S and a molecular weight of 495.52 g/mol. Its IUPAC name is N-butyl-2-[(2-chlorophenyl)methyl-[4-(4-chlorophenyl)sulfanylbutanoyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2-chlorophenyl)methyl-[4-(4-chlorophenyl)sulfanylbutanoyl]amino]butanamide |
|---|---|
| PubChem CID | 132946123 |
| Molecular Formula | C25H32Cl2N2O2S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-butyl-2-[(2-chlorophenyl)methyl-[4-(4-chlorophenyl)sulfanylbutanoyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1Cl)C(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H32Cl2N2O2S/c1-3-5-16-28-25(31)23(4-2)29(18-19-9-6-7-10-22(19)27)24(30)11-8-17-32-21-14-12-20(26)13-15-21/h6-7,9-10,12-15,23H,3-5,8,11,16-18H2,1-2H3,(H,28,31) |
| InChIKey | ZGNZGYXXNNWZSH-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|