C22H26Cl2N2O2S — CID 132675315
2-[(2-chlorophenyl)methyl-[3-(4-chlorophenyl)sulfanylpropanoyl]amino]-N-ethylbutanamide (PubChem CID 132675315) has the molecular formula C22H26Cl2N2O2S and a molecular weight of 453.44 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[3-(4-chlorophenyl)sulfanylpropanoyl]amino]-N-ethylbutanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-[3-(4-chlorophenyl)sulfanylpropanoyl]amino]-N-ethylbutanamide |
|---|---|
| PubChem CID | 132675315 |
| Molecular Formula | C22H26Cl2N2O2S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[3-(4-chlorophenyl)sulfanylpropanoyl]amino]-N-ethylbutanamide |
| SMILES | CCNC(=O)C(CC)N(Cc1ccccc1Cl)C(=O)CCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26Cl2N2O2S/c1-3-20(22(28)25-4-2)26(15-16-7-5-6-8-19(16)24)21(27)13-14-29-18-11-9-17(23)10-12-18/h5-12,20H,3-4,13-15H2,1-2H3,(H,25,28) |
| InChIKey | IBIYFJRSPYFPJV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |