C24H29Cl3N2O2 — CID 132986806
N-butyl-2-[3-(2-chlorophenyl)propanoyl-[(2,6-dichlorophenyl)methyl]amino]butanamide (PubChem CID 132986806) has the molecular formula C24H29Cl3N2O2 and a molecular weight of 483.87 g/mol. Its IUPAC name is N-butyl-2-[3-(2-chlorophenyl)propanoyl-[(2,6-dichlorophenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[3-(2-chlorophenyl)propanoyl-[(2,6-dichlorophenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132986806 |
| Molecular Formula | C24H29Cl3N2O2 |
| Molecular Weight | 483.87 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-butyl-2-[3-(2-chlorophenyl)propanoyl-[(2,6-dichlorophenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1c(Cl)cccc1Cl)C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C24H29Cl3N2O2/c1-3-5-15-28-24(31)22(4-2)29(16-18-20(26)11-8-12-21(18)27)23(30)14-13-17-9-6-7-10-19(17)25/h6-12,22H,3-5,13-16H2,1-2H3,(H,28,31) |
| InChIKey | IQMGGTZUGYKFGO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.87 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|