C31H36Cl2N2O2 — CID 133204441
N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]-3-phenylpropanamide (PubChem CID 133204441) has the molecular formula C31H36Cl2N2O2 and a molecular weight of 539.55 g/mol. Its IUPAC name is N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133204441 |
| Molecular Formula | C31H36Cl2N2O2 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CCc1ccc(CC)cc1 |
| InChI | InChI=1S/C31H36Cl2N2O2/c1-3-5-20-34-31(37)29(21-25-10-7-6-8-11-25)35(22-26-27(32)12-9-13-28(26)33)30(36)19-18-24-16-14-23(4-2)15-17-24/h6-17,29H,3-5,18-22H2,1-2H3,(H,34,37) |
| InChIKey | SDNQKKDLSCAWNS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|