C30H32Cl2N2O4 — CID 133204446
2-[3-(1,3-benzodioxol-5-yl)propanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133204446) has the molecular formula C30H32Cl2N2O4 and a molecular weight of 555.50 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)propanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)propanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133204446 |
| Molecular Formula | C30H32Cl2N2O4 |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)propanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H32Cl2N2O4/c1-2-3-16-33-30(36)26(17-21-8-5-4-6-9-21)34(19-23-24(31)10-7-11-25(23)32)29(35)15-13-22-12-14-27-28(18-22)38-20-37-27/h4-12,14,18,26H,2-3,13,15-17,19-20H2,1H3,(H,33,36) |
| InChIKey | ZBTRNNBTOIEUQO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|